C24H22F6O2S2 — CID 130197511
1,3-bis[4-(trifluoromethylsulfanyloxy)phenyl]adamantane (PubChem CID 130197511) has the molecular formula C24H22F6O2S2 and a molecular weight of 520.56 g/mol. Its IUPAC name is 1,3-bis[4-(trifluoromethylsulfanyloxy)phenyl]adamantane.
| Compound Name | 1,3-bis[4-(trifluoromethylsulfanyloxy)phenyl]adamantane |
|---|---|
| PubChem CID | 130197511 |
| Molecular Formula | C24H22F6O2S2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 1,3-bis[4-(trifluoromethylsulfanyloxy)phenyl]adamantane |
| SMILES | FC(F)(F)SOc1ccc(C23CC4CC(C2)CC(c2ccc(OSC(F)(F)F)cc2)(C4)C3)cc1 |
| InChI | InChI=1S/C24H22F6O2S2/c25-23(26,27)33-31-19-5-1-17(2-6-19)21-10-15-9-16(11-21)13-22(12-15,14-21)18-3-7-20(8-4-18)32-34-24(28,29)30/h1-8,15-16H,9-14H2 |
| InChIKey | MSKPJLKTNNJKFQ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|