C24H28N2O5S — CID 24811561
[3-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]phenyl] sulfamate (PubChem CID 24811561) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is [3-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]phenyl] sulfamate.
| Compound Name | [3-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]phenyl] sulfamate |
|---|---|
| PubChem CID | 24811561 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [3-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1cccc(NC(=O)COc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C24H28N2O5S/c25-32(28,29)31-22-3-1-2-20(11-22)26-23(27)15-30-21-6-4-19(5-7-21)24-12-16-8-17(13-24)10-18(9-16)14-24/h1-7,11,16-18H,8-10,12-15H2,(H,26,27)(H2,25,28,29) |
| InChIKey | WTPDKIZPQJVSEP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |