C36H50Cl2N2O4S — CID 171686660
bis(1-[3-(4-chlorophenyl)-1-adamantyl]ethanamine);sulfuric acid (PubChem CID 171686660) has the molecular formula C36H50Cl2N2O4S and a molecular weight of 677.78 g/mol. Its IUPAC name is bis(1-[3-(4-chlorophenyl)-1-adamantyl]ethanamine);sulfuric acid.
| Compound Name | bis(1-[3-(4-chlorophenyl)-1-adamantyl]ethanamine);sulfuric acid |
|---|---|
| PubChem CID | 171686660 |
| Molecular Formula | C36H50Cl2N2O4S |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | bis(1-[3-(4-chlorophenyl)-1-adamantyl]ethanamine);sulfuric acid |
| SMILES | CC(N)C12CC3CC(CC(c4ccc(Cl)cc4)(C3)C1)C2.CC(N)C12CC3CC(CC(c4ccc(Cl)cc4)(C3)C1)C2.O=S(=O)(O)O |
| InChI | InChI=1S/2C18H24ClN.H2O4S/c2*1-12(20)17-7-13-6-14(8-17)10-18(9-13,11-17)15-2-4-16(19)5-3-15;1-5(2,3)4/h2*2-5,12-14H,6-11,20H2,1H3;(H2,1,2,3,4) |
| InChIKey | JFCAGLJLJDYLHH-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|