C30H38ClN — CID 98249020
N-[(1S)-1-[(5S,7S)-3-(4-chlorophenyl)-1-adamantyl]ethyl]-4-phenylcyclohexan-1-amine (PubChem CID 98249020) has the molecular formula C30H38ClN and a molecular weight of 448.09 g/mol. Its IUPAC name is N-[(1S)-1-[(5S,7S)-3-(4-chlorophenyl)-1-adamantyl]ethyl]-4-phenylcyclohexan-1-amine.
| Compound Name | N-[(1S)-1-[(5S,7S)-3-(4-chlorophenyl)-1-adamantyl]ethyl]-4-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 98249020 |
| Molecular Formula | C30H38ClN |
| Molecular Weight | 448.09 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | N-[(1S)-1-[(5S,7S)-3-(4-chlorophenyl)-1-adamantyl]ethyl]-4-phenylcyclohexan-1-amine |
| SMILES | C[C@H](NC1CCC(c2ccccc2)CC1)C12C[C@H]3C[C@@H](CC(c4ccc(Cl)cc4)(C3)C1)C2 |
| InChI | InChI=1S/C30H38ClN/c1-21(32-28-13-7-25(8-14-28)24-5-3-2-4-6-24)29-16-22-15-23(17-29)19-30(18-22,20-29)26-9-11-27(31)12-10-26/h2-6,9-12,21-23,25,28,32H,7-8,13-20H2,1H3/t21-,22+,23+,25?,28?,29?,30?/m0/s1 |
| InChIKey | CSXZYXPJCVPWSX-VCESLXHASA-N |
| XLogP | 7.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.09 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |