C25H36ClN2O+ — CID 7463767
(1-acetylpiperidin-4-yl)-[(1R)-1-[(5S,7R)-3-(4-chlorophenyl)-1-adamantyl]ethyl]azanium (PubChem CID 7463767) has the molecular formula C25H36ClN2O+ and a molecular weight of 416.03 g/mol. Its IUPAC name is (1-acetylpiperidin-4-yl)-[(1R)-1-[(5S,7R)-3-(4-chlorophenyl)-1-adamantyl]ethyl]azanium.
| Compound Name | (1-acetylpiperidin-4-yl)-[(1R)-1-[(5S,7R)-3-(4-chlorophenyl)-1-adamantyl]ethyl]azanium |
|---|---|
| PubChem CID | 7463767 |
| Molecular Formula | C25H36ClN2O+ |
| Molecular Weight | 416.03 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (1-acetylpiperidin-4-yl)-[(1R)-1-[(5S,7R)-3-(4-chlorophenyl)-1-adamantyl]ethyl]azanium |
| SMILES | CC(=O)N1CCC([NH2+][C@H](C)C23C[C@@H]4C[C@@H](CC(c5ccc(Cl)cc5)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C25H35ClN2O/c1-17(27-23-7-9-28(10-8-23)18(2)29)24-12-19-11-20(13-24)15-25(14-19,16-24)21-3-5-22(26)6-4-21/h3-6,17,19-20,23,27H,7-16H2,1-2H3/p+1/t17-,19-,20+,24?,25?/m1/s1 |
| InChIKey | MEKRHULCOKGYIL-BSJYABEZSA-O |
| XLogP | 4.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.03 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |