C20H29NO — CID 98161321
(1S)-2-(dimethylamino)-1-[(5R,7R)-3-phenyl-1-adamantyl]ethanol (PubChem CID 98161321) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (1S)-2-(dimethylamino)-1-[(5R,7R)-3-phenyl-1-adamantyl]ethanol.
| Compound Name | (1S)-2-(dimethylamino)-1-[(5R,7R)-3-phenyl-1-adamantyl]ethanol |
|---|---|
| PubChem CID | 98161321 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (1S)-2-(dimethylamino)-1-[(5R,7R)-3-phenyl-1-adamantyl]ethanol |
| SMILES | CN(C)C[C@@H](O)C12C[C@@H]3C[C@H](CC(c4ccccc4)(C3)C1)C2 |
| InChI | InChI=1S/C20H29NO/c1-21(2)13-18(22)20-11-15-8-16(12-20)10-19(9-15,14-20)17-6-4-3-5-7-17/h3-7,15-16,18,22H,8-14H2,1-2H3/t15-,16-,18-,19?,20?/m1/s1 |
| InChIKey | NIRBDHSDDLHSCH-YYOBMREJSA-N |
| XLogP | 3.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |