C14H23F2N — CID 159327606
N-(1-adamantylmethyl)-2,2-difluoropropan-1-amine (PubChem CID 159327606) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,2-difluoropropan-1-amine.
| Compound Name | N-(1-adamantylmethyl)-2,2-difluoropropan-1-amine |
|---|---|
| PubChem CID | 159327606 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-(1-adamantylmethyl)-2,2-difluoropropan-1-amine |
| SMILES | CC(F)(F)CNCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H23F2N/c1-13(15,16)8-17-9-14-5-10-2-11(6-14)4-12(3-10)7-14/h10-12,17H,2-9H2,1H3 |
| InChIKey | FTIKCUWMEWFBGM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |