C14H26N2 — CID 104867855
(2S)-2-N-(1-adamantylmethyl)propane-1,2-diamine (PubChem CID 104867855) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2S)-2-N-(1-adamantylmethyl)propane-1,2-diamine.
| Compound Name | (2S)-2-N-(1-adamantylmethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 104867855 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2S)-2-N-(1-adamantylmethyl)propane-1,2-diamine |
| SMILES | C[C@@H](CN)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H26N2/c1-10(8-15)16-9-14-5-11-2-12(6-14)4-13(3-11)7-14/h10-13,16H,2-9,15H2,1H3/t10-,11?,12?,13?,14?/m0/s1 |
| InChIKey | QRXYAEYPFSDBNV-MWKHJINRSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |