C20H29NO — CID 10637907
(1R,2S)-2-(1-adamantylmethylamino)-1-phenylpropan-1-ol (PubChem CID 10637907) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (1R,2S)-2-(1-adamantylmethylamino)-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(1-adamantylmethylamino)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 10637907 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (1R,2S)-2-(1-adamantylmethylamino)-1-phenylpropan-1-ol |
| SMILES | C[C@H](NCC12CC3CC(CC(C3)C1)C2)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H29NO/c1-14(19(22)18-5-3-2-4-6-18)21-13-20-10-15-7-16(11-20)9-17(8-15)12-20/h2-6,14-17,19,21-22H,7-13H2,1H3/t14-,15?,16?,17?,19-,20?/m0/s1 |
| InChIKey | DLIPOXICRIZLMF-KMOCJBKRSA-N |
| XLogP | 3.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |