C17H31N2O+ — CID 7071750
[2-(1-adamantylmethylamino)-2-oxoethyl]-tert-butylazanium (PubChem CID 7071750) has the molecular formula C17H31N2O+ and a molecular weight of 279.45 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl]-tert-butylazanium.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl]-tert-butylazanium |
|---|---|
| PubChem CID | 7071750 |
| Molecular Formula | C17H31N2O+ |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl]-tert-butylazanium |
| SMILES | CC(C)(C)[NH2+]CC(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H30N2O/c1-16(2,3)19-10-15(20)18-11-17-7-12-4-13(8-17)6-14(5-12)9-17/h12-14,19H,4-11H2,1-3H3,(H,18,20)/p+1 |
| InChIKey | IFBVJUOBGAOLQH-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |