C19H31N3O3 — CID 22110836
ethyl 4-(1-adamantylmethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 22110836) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is ethyl 4-(1-adamantylmethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(1-adamantylmethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22110836 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | ethyl 4-(1-adamantylmethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)NCC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C19H31N3O3/c1-2-25-18(24)22-5-3-21(4-6-22)17(23)20-13-19-10-14-7-15(11-19)9-16(8-14)12-19/h14-16H,2-13H2,1H3,(H,20,23) |
| InChIKey | CNMZHSGIAOLRKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |