C18H30N2O2 — CID 96543593
(3S)-N-(1-adamantylmethyl)-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 96543593) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3S)-N-(1-adamantylmethyl)-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(1-adamantylmethyl)-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 96543593 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (3S)-N-(1-adamantylmethyl)-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)N1CCC[C@H](CO)C1 |
| InChI | InChI=1S/C18H30N2O2/c21-11-13-2-1-3-20(10-13)17(22)19-12-18-7-14-4-15(8-18)6-16(5-14)9-18/h13-16,21H,1-12H2,(H,19,22)/t13-,14?,15?,16?,18?/m0/s1 |
| InChIKey | QKLCPAZLCZVMIS-IILDEKEXSA-N |
| XLogP | 2.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |