C20H31NO — CID 25362197
N-(1-adamantylmethyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 25362197) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 25362197 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@@H]1C2)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H31NO/c22-19(8-18-7-13-1-2-17(18)6-13)21-12-20-9-14-3-15(10-20)5-16(4-14)11-20/h13-18H,1-12H2,(H,21,22)/t13-,14?,15?,16?,17+,18-,20?/m0/s1 |
| InChIKey | DLFGIOABLIJWKZ-MLRXMUJOSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |