About N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide
N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide (PubChem CID 23308521) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide |
| PubChem CID | 23308521 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide |
| SMILES | CC(=O)NCC12CC3C[C@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C14H23NO/c1-10(16)15-9-14-6-11-2-3-12(7-14)5-13(4-11)8-14/h11-13H,2-9H2,1H3,(H,15,16)/t11-,12-,13?,14?/m0/s1 |
| InChIKey | SGJRCMOERMHYOG-FEPKRQSRSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide?
The IUPAC name of N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide (CID 23308521) is N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide.
What is the SMILES notation for N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide?
The canonical SMILES for N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide is CC(=O)NCC12CC3C[C@H](CC[C@@H](C3)C1)C2.
What is the InChIKey of N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide?
The InChIKey is SGJRCMOERMHYOG-FEPKRQSRSA-N. The full InChI is InChI=1S/C14H23NO/c1-10(16)15-9-14-6-11-2-3-12(7-14)5-13(4-11)8-14/h11-13H,2-9H2,1H3,(H,15,16)/t11-,12-,13?,14?/m0/s1.
What are the key properties of N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide?
N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide has a molecular weight of 221.34 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]acetamide is sourced from PubChem (CID 23308521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).