About 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea
1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea (PubChem CID 108870433) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea.
Molecular Properties
| Compound Name | 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea |
| PubChem CID | 108870433 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea |
| SMILES | COC(CNC(=O)NCC12CC3CC(CC(C3)C1)C2)OC |
| InChI | InChI=1S/C16H28N2O3/c1-20-14(21-2)9-17-15(19)18-10-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-14H,3-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | KUDWKHXIIYYBCT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea?
The IUPAC name of 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea (CID 108870433) is 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea.
What is the SMILES notation for 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea?
The canonical SMILES for 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea is COC(CNC(=O)NCC12CC3CC(CC(C3)C1)C2)OC.
What is the InChIKey of 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea?
The InChIKey is KUDWKHXIIYYBCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O3/c1-20-14(21-2)9-17-15(19)18-10-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-14H,3-10H2,1-2H3,(H2,17,18,19).
What are the key properties of 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea?
1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea has a molecular weight of 296.41 g/mol, XLogP of 2.12, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantylmethyl)-3-(2,2-dimethoxyethyl)urea is sourced from PubChem (CID 108870433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).