C15H21Cl2NO — CID 78780282
N-(1-adamantylmethyl)-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 78780282) has the molecular formula C15H21Cl2NO and a molecular weight of 302.25 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78780282 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(1-adamantylmethyl)-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)C1CC1(Cl)Cl |
| InChI | InChI=1S/C15H21Cl2NO/c16-15(17)7-12(15)13(19)18-8-14-4-9-1-10(5-14)3-11(2-9)6-14/h9-12H,1-8H2,(H,18,19) |
| InChIKey | ZRDYCVRKCKZQNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|