C23H34ClNO — CID 15998261
N-(1-adamantylmethyl)-2-(3-chloro-1-adamantyl)acetamide (PubChem CID 15998261) has the molecular formula C23H34ClNO and a molecular weight of 375.98 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(3-chloro-1-adamantyl)acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-(3-chloro-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 15998261 |
| Molecular Formula | C23H34ClNO |
| Molecular Weight | 375.98 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(3-chloro-1-adamantyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(Cl)(C3)C1)C2)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34ClNO/c24-23-10-18-4-19(11-23)9-21(8-18,13-23)12-20(26)25-14-22-5-15-1-16(6-22)3-17(2-15)7-22/h15-19H,1-14H2,(H,25,26) |
| InChIKey | NVYJJHNLUWLRMW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.98 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|