C21H28ClN3O2 — CID 99850307
(2S)-2-(carbamoylamino)-N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-phenylpropanamide (PubChem CID 99850307) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-(carbamoylamino)-N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 99850307 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2S)-2-(carbamoylamino)-N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-phenylpropanamide |
| SMILES | NC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C21H28ClN3O2/c22-21-10-15-6-16(11-21)9-20(8-15,12-21)13-24-18(26)17(25-19(23)27)7-14-4-2-1-3-5-14/h1-5,15-17H,6-13H2,(H,24,26)(H3,23,25,27)/t15-,16-,17+,20?,21?/m1/s1 |
| InChIKey | SLBDYNPOLNNDQV-QGGNESHTSA-N |
| XLogP | 2.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|