C19H21ClN4O3 — CID 86921350
N-[2-[[2-(carbamoylamino)-3-phenylpropanoyl]amino]ethyl]-4-chlorobenzamide (PubChem CID 86921350) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is N-[2-[[2-(carbamoylamino)-3-phenylpropanoyl]amino]ethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[[2-(carbamoylamino)-3-phenylpropanoyl]amino]ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 86921350 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[2-[[2-(carbamoylamino)-3-phenylpropanoyl]amino]ethyl]-4-chlorobenzamide |
| SMILES | NC(=O)NC(Cc1ccccc1)C(=O)NCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN4O3/c20-15-8-6-14(7-9-15)17(25)22-10-11-23-18(26)16(24-19(21)27)12-13-4-2-1-3-5-13/h1-9,16H,10-12H2,(H,22,25)(H,23,26)(H3,21,24,27) |
| InChIKey | XUUCRBKIJRFVDL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|