C19H19ClN2O2 — CID 4882562
4-chloro-N-[1-oxo-3-phenyl-1-(prop-2-enylamino)propan-2-yl]benzamide (PubChem CID 4882562) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 4-chloro-N-[1-oxo-3-phenyl-1-(prop-2-enylamino)propan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-oxo-3-phenyl-1-(prop-2-enylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 4882562 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-chloro-N-[1-oxo-3-phenyl-1-(prop-2-enylamino)propan-2-yl]benzamide |
| SMILES | C=CCNC(=O)C(Cc1ccccc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-2-12-21-19(24)17(13-14-6-4-3-5-7-14)22-18(23)15-8-10-16(20)11-9-15/h2-11,17H,1,12-13H2,(H,21,24)(H,22,23) |
| InChIKey | URFLWQXIXDMANY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|