C23H21ClN2O2 — CID 7478462
N-[(2S)-1-[(3-chlorophenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 7478462) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[(2S)-1-[(3-chlorophenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[(3-chlorophenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 7478462 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(2S)-1-[(3-chlorophenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NCc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H21ClN2O2/c24-20-13-7-10-18(14-20)16-25-23(28)21(15-17-8-3-1-4-9-17)26-22(27)19-11-5-2-6-12-19/h1-14,21H,15-16H2,(H,25,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | QKHOFZRFKHAGDH-NRFANRHFSA-N |
| XLogP | 4.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |