C19H25NO4 — CID 51706353
(1S,2R,3S,4R)-3-(1-adamantylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 51706353) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-(1-adamantylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4R)-3-(1-adamantylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 51706353 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (1S,2R,3S,4R)-3-(1-adamantylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H](C(=O)NCC23CC4CC(CC(C4)C2)C3)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C19H25NO4/c21-17(15-13-1-2-14(24-13)16(15)18(22)23)20-9-19-6-10-3-11(7-19)5-12(4-10)8-19/h1-2,10-16H,3-9H2,(H,20,21)(H,22,23)/t10?,11?,12?,13-,14+,15-,16+,19?/m1/s1 |
| InChIKey | PTQYCZUBYRLQBS-ZSVYHXPESA-N |
| XLogP | 1.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|