C29H31NO3 — CID 10433426
(15R,16S)-16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid (PubChem CID 10433426) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is (15R,16S)-16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid.
| Compound Name | (15R,16S)-16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
|---|---|
| PubChem CID | 10433426 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (15R,16S)-16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C2c3ccccc3C(c3ccccc32)[C@@H]1C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H31NO3/c31-27(30-15-29-12-16-9-17(13-29)11-18(10-16)14-29)25-23-19-5-1-3-7-21(19)24(26(25)28(32)33)22-8-4-2-6-20(22)23/h1-8,16-18,23-26H,9-15H2,(H,30,31)(H,32,33)/t16?,17?,18?,23?,24?,25-,26+,29?/m0/s1 |
| InChIKey | LJICKOHUCGTRKC-MCMYSHFBSA-N |
| XLogP | 4.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |