C46H45N3O7 — CID 10676550
4-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]phthalic acid (PubChem CID 10676550) has the molecular formula C46H45N3O7 and a molecular weight of 751.88 g/mol. Its IUPAC name is 4-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]phthalic acid.
| Compound Name | 4-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]phthalic acid |
|---|---|
| PubChem CID | 10676550 |
| Molecular Formula | C46H45N3O7 |
| Molecular Weight | 751.88 g/mol |
| Exact Mass | 751.33 |
| IUPAC Name | 4-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]phthalic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)C2C3c4ccccc4C(c4ccccc43)C2C(=O)NCC23CC4CC(CC(C4)C2)C3)cc1C(=O)O |
| InChI | InChI=1S/C46H45N3O7/c50-41(48-29-14-15-34(44(53)54)35(20-29)45(55)56)36(19-25-8-2-1-3-9-25)49-43(52)40-38-32-12-6-4-10-30(32)37(31-11-5-7-13-33(31)38)39(40)42(51)47-24-46-21-26-16-27(22-46)18-28(17-26)23-46/h1-15,20,26-28,36-40H,16-19,21-24H2,(H,47,51)(H,48,50)(H,49,52)(H,53,54)(H,55,56)/t26?,27?,28?,36-,37?,38?,39?,40?,46?/m0/s1 |
| InChIKey | HMOZNQRMMQTHID-LUFPAJECSA-N |
| XLogP | 6.61 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.88 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |