C41H43N3O7 — CID 67778990
5-[[(2R)-2-[[(1S,8R)-10-(1-adamantylmethylcarbamoyl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3-carbonyl]amino]-3-phenylpropanoyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 67778990) has the molecular formula C41H43N3O7 and a molecular weight of 689.81 g/mol. Its IUPAC name is 5-[[(2R)-2-[[(1S,8R)-10-(1-adamantylmethylcarbamoyl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3-carbonyl]amino]-3-phenylpropanoyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[(2R)-2-[[(1S,8R)-10-(1-adamantylmethylcarbamoyl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3-carbonyl]amino]-3-phenylpropanoyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 67778990 |
| Molecular Formula | C41H43N3O7 |
| Molecular Weight | 689.81 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | 5-[[(2R)-2-[[(1S,8R)-10-(1-adamantylmethylcarbamoyl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3-carbonyl]amino]-3-phenylpropanoyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2cccc3c2[C@H]2C[C@@H]3CC2C(=O)NCC23CC4CC(CC(C4)C2)C3)cc(C(=O)O)c1 |
| InChI | InChI=1S/C41H43N3O7/c45-36(42-21-41-18-23-9-24(19-41)11-25(10-23)20-41)33-17-26-16-32(33)35-30(26)7-4-8-31(35)37(46)44-34(12-22-5-2-1-3-6-22)38(47)43-29-14-27(39(48)49)13-28(15-29)40(50)51/h1-8,13-15,23-26,32-34H,9-12,16-21H2,(H,42,45)(H,43,47)(H,44,46)(H,48,49)(H,50,51)/t23?,24?,25?,26-,32+,33?,34-,41?/m1/s1 |
| InChIKey | KYEIHPGBNLTGCA-MPWPSLIQSA-N |
| XLogP | 5.99 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.81 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |