C10H15Cl2NO2S — CID 95987655
(1R)-2,2-dichloro-N-[(4-hydroxythian-4-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 95987655) has the molecular formula C10H15Cl2NO2S and a molecular weight of 284.21 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[(4-hydroxythian-4-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[(4-hydroxythian-4-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95987655 |
| Molecular Formula | C10H15Cl2NO2S |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (1R)-2,2-dichloro-N-[(4-hydroxythian-4-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCC1(O)CCSCC1)[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C10H15Cl2NO2S/c11-10(12)5-7(10)8(14)13-6-9(15)1-3-16-4-2-9/h7,15H,1-6H2,(H,13,14)/t7-/m1/s1 |
| InChIKey | BSQKEHWNABSYNN-SSDOTTSWSA-N |
| XLogP | 1.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|