C5H3F9NO5S2- — CID 140897825
methoxysulfonyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide (PubChem CID 140897825) has the molecular formula C5H3F9NO5S2- and a molecular weight of 392.20 g/mol. Its IUPAC name is methoxysulfonyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide.
| Compound Name | methoxysulfonyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide |
|---|---|
| PubChem CID | 140897825 |
| Molecular Formula | C5H3F9NO5S2- |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | methoxysulfonyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide |
| SMILES | COS(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9NO5S2/c1-20-22(18,19)15-21(16,17)5(13,14)3(8,9)2(6,7)4(10,11)12/h1H3/q-1 |
| InChIKey | MTQHCEDWHBRFDX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|