C15H5F27O3S — CID 134585159
ethyl 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosafluorotridecane-2-sulfonate (PubChem CID 134585159) has the molecular formula C15H5F27O3S and a molecular weight of 778.21 g/mol. Its IUPAC name is ethyl 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosafluorotridecane-2-sulfonate.
| Compound Name | ethyl 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosafluorotridecane-2-sulfonate |
|---|---|
| PubChem CID | 134585159 |
| Molecular Formula | C15H5F27O3S |
| Molecular Weight | 778.21 g/mol |
| Exact Mass | 777.95 |
| IUPAC Name | ethyl 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosafluorotridecane-2-sulfonate |
| SMILES | CCOS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H5F27O3S/c1-2-45-46(43,44)13(36,15(40,41)42)11(32,33)9(28,29)7(24,25)5(20,21)3(16,17)4(18,19)6(22,23)8(26,27)10(30,31)12(34,35)14(37,38)39/h2H2,1H3 |
| InChIKey | SYDQSBGSMLYGAZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.21 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|