C18H20F21NO3S — CID 87186931
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonate;tetraethylazanium (PubChem CID 87186931) has the molecular formula C18H20F21NO3S and a molecular weight of 729.39 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonate;tetraethylazanium.
| Compound Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 87186931 |
| Molecular Formula | C18H20F21NO3S |
| Molecular Weight | 729.39 g/mol |
| Exact Mass | 729.08 |
| IUPAC Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10HF21O3S.C8H20N/c11-1(12,3(15,16)5(19,20)7(23,24)9(26,27)28)2(13,14)4(17,18)6(21,22)8(25,10(29,30)31)35(32,33)34;1-5-9(6-2,7-3)8-4/h(H,32,33,34);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | QMPNACCZPIDJFF-UHFFFAOYSA-M |
| XLogP | 7.65 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.39 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|