C16H20F18NO3S+ — CID 174625555
tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 1,1,2,2,2-pentafluoroethanesulfonate (PubChem CID 174625555) has the molecular formula C16H20F18NO3S+ and a molecular weight of 648.37 g/mol. Its IUPAC name is tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 1,1,2,2,2-pentafluoroethanesulfonate.
| Compound Name | tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 1,1,2,2,2-pentafluoroethanesulfonate |
|---|---|
| PubChem CID | 174625555 |
| Molecular Formula | C16H20F18NO3S+ |
| Molecular Weight | 648.37 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 1,1,2,2,2-pentafluoroethanesulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F18O3S.C8H20N/c9-1(10,3(13,14)5(17,18)19)2(11,12)4(15,16)7(23,24)29-30(27,28)8(25,26)6(20,21)22;1-5-9(6-2,7-3)8-4/h;5-8H2,1-4H3/q;+1 |
| InChIKey | JZRVDPORFQLPOF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.37 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|