C16H15F15O6S — CID 139799160
tert-butyl 2-[difluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyloxy)methyl]-2-methyl-3-oxobutanoate (PubChem CID 139799160) has the molecular formula C16H15F15O6S and a molecular weight of 620.33 g/mol. Its IUPAC name is tert-butyl 2-[difluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyloxy)methyl]-2-methyl-3-oxobutanoate.
| Compound Name | tert-butyl 2-[difluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyloxy)methyl]-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 139799160 |
| Molecular Formula | C16H15F15O6S |
| Molecular Weight | 620.33 g/mol |
| Exact Mass | 620.03 |
| IUPAC Name | tert-butyl 2-[difluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyloxy)methyl]-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)(C(=O)OC(C)(C)C)C(F)(F)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H15F15O6S/c1-6(32)9(5,7(33)36-8(2,3)4)15(28,29)37-38(34,35)16(30,31)13(23,24)11(19,20)10(17,18)12(21,22)14(25,26)27/h1-5H3 |
| InChIKey | RLFYCKHKYQLYAI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.33 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|