C8H9F9IO3S+ — CID 102270071
tert-butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)iodanium (PubChem CID 102270071) has the molecular formula C8H9F9IO3S+ and a molecular weight of 483.11 g/mol. Its IUPAC name is tert-butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)iodanium.
| Compound Name | tert-butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)iodanium |
|---|---|
| PubChem CID | 102270071 |
| Molecular Formula | C8H9F9IO3S+ |
| Molecular Weight | 483.11 g/mol |
| Exact Mass | 482.92 |
| IUPAC Name | tert-butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)iodanium |
| SMILES | CC(C)(C)[I+]OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9IO3S/c1-4(2,3)18-21-22(19,20)8(16,17)6(11,12)5(9,10)7(13,14)15/h1-3H3/q+1 |
| InChIKey | NZZJZTIRJRPTTO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.11 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|