C12H6F17NO4S — CID 87579499
[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)ethyl] 2-methylprop-2-enoate (PubChem CID 87579499) has the molecular formula C12H6F17NO4S and a molecular weight of 583.22 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)ethyl] 2-methylprop-2-enoate.
| Compound Name | [1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87579499 |
| Molecular Formula | C12H6F17NO4S |
| Molecular Weight | 583.22 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | [1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F17NO4S/c1-3(2)4(31)34-11(26,27)10(24,25)30-35(32,33)12(28,29)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)23/h30H,1H2,2H3 |
| InChIKey | JHDLCBGAUGWZSO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|