C16H14F17NO4S — CID 88844275
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)butyl 2-methylprop-2-enoate (PubChem CID 88844275) has the molecular formula C16H14F17NO4S and a molecular weight of 639.32 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)butyl 2-methylprop-2-enoate.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88844275 |
| Molecular Formula | C16H14F17NO4S |
| Molecular Weight | 639.32 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F17NO4S/c1-4-5-7(38-8(35)6(2)3)34-39(36,37)16(32,33)14(27,28)12(23,24)10(19,20)9(17,18)11(21,22)13(25,26)15(29,30)31/h7,34H,2,4-5H2,1,3H3 |
| InChIKey | PQOAXWVLLIDGKM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|