C12H11F17N2O2S — CID 21251997
N-[1-(ethylamino)ethyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide (PubChem CID 21251997) has the molecular formula C12H11F17N2O2S and a molecular weight of 570.26 g/mol. Its IUPAC name is N-[1-(ethylamino)ethyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide.
| Compound Name | N-[1-(ethylamino)ethyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
|---|---|
| PubChem CID | 21251997 |
| Molecular Formula | C12H11F17N2O2S |
| Molecular Weight | 570.26 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | N-[1-(ethylamino)ethyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| SMILES | CCNC(C)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F17N2O2S/c1-3-30-4(2)31-34(32,33)12(28,29)10(23,24)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)11(25,26)27/h4,30-31H,3H2,1-2H3 |
| InChIKey | QFSXIWVIPXXPNN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|