C22H12F30O2 — CID 123140049
[5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)dodecan-3-yl] 2-methylprop-2-enoate (PubChem CID 123140049) has the molecular formula C22H12F30O2 and a molecular weight of 878.28 g/mol. Its IUPAC name is [5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)dodecan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)dodecan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123140049 |
| Molecular Formula | C22H12F30O2 |
| Molecular Weight | 878.28 g/mol |
| Exact Mass | 878.04 |
| IUPAC Name | [5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)dodecan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H12F30O2/c1-4-6(54-8(53)5(2)3)7(10(25,26)12(29,30)14(33,34)17(39,40)19(43,44)21(47,48)49)9(23,24)11(27,28)13(31,32)15(35,36)16(37,38)18(41,42)20(45,46)22(50,51)52/h6-7H,2,4H2,1,3H3 |
| InChIKey | KBHFBNLNRQTHBE-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.28 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|