C30H14F38O8 — CID 167596936
[3-(2-methylprop-2-enoyloxy)-2,4-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyloxy)butyl] 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanoate (PubChem CID 167596936) has the molecular formula C30H14F38O8 and a molecular weight of 1224.36 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-2,4-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyloxy)butyl] 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-2,4-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyloxy)butyl] 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanoate |
|---|---|
| PubChem CID | 167596936 |
| Molecular Formula | C30H14F38O8 |
| Molecular Weight | 1224.36 g/mol |
| Exact Mass | 1224.01 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-2,4-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyloxy)butyl] 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanoate |
| SMILES | C=C(C)C(=O)OC(COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F)OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H14F38O8/c1-6(2)9(69)75-7(4-73-10(70)15(35,36)19(43,44)23(51,52)25(55,56)27(59,60)29(63,64)65)8(76-12(72)16(37,38)20(45,46)24(53,54)26(57,58)28(61,62)30(66,67)68)5-74-11(71)14(33,34)18(41,42)22(49,50)21(47,48)17(39,40)13(3,31)32/h7-8H,1,4-5H2,2-3H3 |
| InChIKey | FSCXNFAOODLTMQ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1224.36 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|