C8H10F4O3 — CID 21187236
(2,2,3,3-tetrafluoro-1-hydroxybutyl) 2-methylprop-2-enoate (PubChem CID 21187236) has the molecular formula C8H10F4O3 and a molecular weight of 230.16 g/mol. Its IUPAC name is (2,2,3,3-tetrafluoro-1-hydroxybutyl) 2-methylprop-2-enoate.
| Compound Name | (2,2,3,3-tetrafluoro-1-hydroxybutyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21187236 |
| Molecular Formula | C8H10F4O3 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (2,2,3,3-tetrafluoro-1-hydroxybutyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(O)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C8H10F4O3/c1-4(2)5(13)15-6(14)8(11,12)7(3,9)10/h6,14H,1H2,2-3H3 |
| InChIKey | QJFMDXIILFUFKE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|