C9H13F3O4 — CID 139912990
(4,4,4-trifluoro-1-hydroxy-1-methoxybutan-2-yl) 2-methylprop-2-enoate (PubChem CID 139912990) has the molecular formula C9H13F3O4 and a molecular weight of 242.19 g/mol. Its IUPAC name is (4,4,4-trifluoro-1-hydroxy-1-methoxybutan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (4,4,4-trifluoro-1-hydroxy-1-methoxybutan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139912990 |
| Molecular Formula | C9H13F3O4 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (4,4,4-trifluoro-1-hydroxy-1-methoxybutan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC(F)(F)F)C(O)OC |
| InChI | InChI=1S/C9H13F3O4/c1-5(2)7(13)16-6(8(14)15-3)4-9(10,11)12/h6,8,14H,1,4H2,2-3H3 |
| InChIKey | SPDNIWHSFSWCOX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|