C20H29F3O8 — CID 134298011
[3,4-bis[(2-fluoro-2-methylpropanoyl)oxy]-2-(2-methylprop-2-enoyloxy)butyl] 2-fluoro-2-methylpropanoate (PubChem CID 134298011) has the molecular formula C20H29F3O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is [3,4-bis[(2-fluoro-2-methylpropanoyl)oxy]-2-(2-methylprop-2-enoyloxy)butyl] 2-fluoro-2-methylpropanoate.
| Compound Name | [3,4-bis[(2-fluoro-2-methylpropanoyl)oxy]-2-(2-methylprop-2-enoyloxy)butyl] 2-fluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 134298011 |
| Molecular Formula | C20H29F3O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [3,4-bis[(2-fluoro-2-methylpropanoyl)oxy]-2-(2-methylprop-2-enoyloxy)butyl] 2-fluoro-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OC(COC(=O)C(C)(C)F)C(COC(=O)C(C)(C)F)OC(=O)C(C)(C)F |
| InChI | InChI=1S/C20H29F3O8/c1-11(2)14(24)30-12(9-28-15(25)18(3,4)21)13(31-17(27)20(7,8)23)10-29-16(26)19(5,6)22/h12-13H,1,9-10H2,2-8H3 |
| InChIKey | NZJUNWLAXGHPAY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|