C21H28F4O6 — CID 121329839
1,3-bis[(2-cyclopentyl-2,2-difluoroacetyl)oxy]propan-2-yl 2-methylprop-2-enoate (PubChem CID 121329839) has the molecular formula C21H28F4O6 and a molecular weight of 452.44 g/mol. Its IUPAC name is 1,3-bis[(2-cyclopentyl-2,2-difluoroacetyl)oxy]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1,3-bis[(2-cyclopentyl-2,2-difluoroacetyl)oxy]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121329839 |
| Molecular Formula | C21H28F4O6 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1,3-bis[(2-cyclopentyl-2,2-difluoroacetyl)oxy]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COC(=O)C(F)(F)C1CCCC1)COC(=O)C(F)(F)C1CCCC1 |
| InChI | InChI=1S/C21H28F4O6/c1-13(2)17(26)31-16(11-29-18(27)20(22,23)14-7-3-4-8-14)12-30-19(28)21(24,25)15-9-5-6-10-15/h14-16H,1,3-12H2,2H3 |
| InChIKey | YVQCODMDKQLQPA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|