C14H20F6O3 — CID 118200750
[1,1,1-trifluoro-2-hydroxy-5,6-dimethyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate (PubChem CID 118200750) has the molecular formula C14H20F6O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-hydroxy-5,6-dimethyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1-trifluoro-2-hydroxy-5,6-dimethyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118200750 |
| Molecular Formula | C14H20F6O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [1,1,1-trifluoro-2-hydroxy-5,6-dimethyl-2-(trifluoromethyl)heptan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC(O)(C(F)(F)F)C(F)(F)F)C(C)C(C)C |
| InChI | InChI=1S/C14H20F6O3/c1-7(2)9(5)10(23-11(21)8(3)4)6-12(22,13(15,16)17)14(18,19)20/h7,9-10,22H,3,6H2,1-2,4-5H3 |
| InChIKey | XCIPXJMQPWMQIZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|