C10H15F3O3 — CID 89260977
[3,5-difluoro-4-(fluoromethyl)-4-hydroxypentan-2-yl] 2-methylprop-2-enoate (PubChem CID 89260977) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is [3,5-difluoro-4-(fluoromethyl)-4-hydroxypentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [3,5-difluoro-4-(fluoromethyl)-4-hydroxypentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89260977 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [3,5-difluoro-4-(fluoromethyl)-4-hydroxypentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(F)C(O)(CF)CF |
| InChI | InChI=1S/C10H15F3O3/c1-6(2)9(14)16-7(3)8(13)10(15,4-11)5-12/h7-8,15H,1,4-5H2,2-3H3 |
| InChIKey | ULDZYJNWVPEDAA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|