C17H22F6O5 — CID 166786576
2-methylprop-2-enoyl (Z)-10,10,10-trifluoro-7,9-dihydroxy-2,5-dimethyl-9-(trifluoromethyl)dec-2-enoate (PubChem CID 166786576) has the molecular formula C17H22F6O5 and a molecular weight of 420.35 g/mol. Its IUPAC name is 2-methylprop-2-enoyl (Z)-10,10,10-trifluoro-7,9-dihydroxy-2,5-dimethyl-9-(trifluoromethyl)dec-2-enoate.
| Compound Name | 2-methylprop-2-enoyl (Z)-10,10,10-trifluoro-7,9-dihydroxy-2,5-dimethyl-9-(trifluoromethyl)dec-2-enoate |
|---|---|
| PubChem CID | 166786576 |
| Molecular Formula | C17H22F6O5 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-methylprop-2-enoyl (Z)-10,10,10-trifluoro-7,9-dihydroxy-2,5-dimethyl-9-(trifluoromethyl)dec-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)/C(C)=C\CC(C)CC(O)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H22F6O5/c1-9(2)13(25)28-14(26)11(4)6-5-10(3)7-12(24)8-15(27,16(18,19)20)17(21,22)23/h6,10,12,24,27H,1,5,7-8H2,2-4H3/b11-6- |
| InChIKey | ZQMVJXMRRUTIIF-WDZFZDKYSA-N |
| XLogP | 3.60 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|