C17H20O6 — CID 88641732
bis(2-methylprop-2-enoyl) 2,4-dimethyl-5-methylidenehex-2-enedioate (PubChem CID 88641732) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is bis(2-methylprop-2-enoyl) 2,4-dimethyl-5-methylidenehex-2-enedioate.
| Compound Name | bis(2-methylprop-2-enoyl) 2,4-dimethyl-5-methylidenehex-2-enedioate |
|---|---|
| PubChem CID | 88641732 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | bis(2-methylprop-2-enoyl) 2,4-dimethyl-5-methylidenehex-2-enedioate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)C(C)C=C(C)C(=O)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H20O6/c1-9(2)14(18)22-16(20)12(6)8-11(5)13(7)17(21)23-15(19)10(3)4/h8,11H,1,3,7H2,2,4-6H3 |
| InChIKey | AGMDAQKSPSBNOW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|