C15H24O5 — CID 174767128
2-methylprop-2-enoyl 4,10-dihydroxy-2-methyldec-2-enoate (PubChem CID 174767128) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 4,10-dihydroxy-2-methyldec-2-enoate.
| Compound Name | 2-methylprop-2-enoyl 4,10-dihydroxy-2-methyldec-2-enoate |
|---|---|
| PubChem CID | 174767128 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-methylprop-2-enoyl 4,10-dihydroxy-2-methyldec-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(C)=CC(O)CCCCCCO |
| InChI | InChI=1S/C15H24O5/c1-11(2)14(18)20-15(19)12(3)10-13(17)8-6-4-5-7-9-16/h10,13,16-17H,1,4-9H2,2-3H3 |
| InChIKey | KCXPHTGLKQDFSE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|