C12H18O3 — CID 174410729
2-methylprop-2-enoyl 2,4-dimethylhex-2-enoate (PubChem CID 174410729) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2,4-dimethylhex-2-enoate.
| Compound Name | 2-methylprop-2-enoyl 2,4-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 174410729 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-methylprop-2-enoyl 2,4-dimethylhex-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(C)=CC(C)CC |
| InChI | InChI=1S/C12H18O3/c1-6-9(4)7-10(5)12(14)15-11(13)8(2)3/h7,9H,2,6H2,1,3-5H3 |
| InChIKey | KEXGFTSOZMYPKY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|