C11H18O6 — CID 173155941
4,6-dihydroxy-2-methylhex-2-enoic acid;2-methylprop-2-enoic acid (PubChem CID 173155941) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 4,6-dihydroxy-2-methylhex-2-enoic acid;2-methylprop-2-enoic acid.
| Compound Name | 4,6-dihydroxy-2-methylhex-2-enoic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 173155941 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4,6-dihydroxy-2-methylhex-2-enoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC(=CC(O)CCO)C(=O)O |
| InChI | InChI=1S/C7H12O4.C4H6O2/c1-5(7(10)11)4-6(9)2-3-8;1-3(2)4(5)6/h4,6,8-9H,2-3H2,1H3,(H,10,11);1H2,2H3,(H,5,6) |
| InChIKey | KKKAPCDBCUOHOW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|