C13H24O4 — CID 90823727
4,12-dihydroxy-2-methyldodec-2-enoic acid (PubChem CID 90823727) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4,12-dihydroxy-2-methyldodec-2-enoic acid.
| Compound Name | 4,12-dihydroxy-2-methyldodec-2-enoic acid |
|---|---|
| PubChem CID | 90823727 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4,12-dihydroxy-2-methyldodec-2-enoic acid |
| SMILES | CC(=CC(O)CCCCCCCCO)C(=O)O |
| InChI | InChI=1S/C13H24O4/c1-11(13(16)17)10-12(15)8-6-4-2-3-5-7-9-14/h10,12,14-15H,2-9H2,1H3,(H,16,17) |
| InChIKey | ZJOGKZUHCWJPSH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|