C28H54O9 — CID 57175199
7-(1,6,9,14-tetrahydroxytetradec-7-en-7-yloxy)tetradec-7-ene-1,6,9,14-tetrol (PubChem CID 57175199) has the molecular formula C28H54O9 and a molecular weight of 534.73 g/mol. Its IUPAC name is 7-(1,6,9,14-tetrahydroxytetradec-7-en-7-yloxy)tetradec-7-ene-1,6,9,14-tetrol.
| Compound Name | 7-(1,6,9,14-tetrahydroxytetradec-7-en-7-yloxy)tetradec-7-ene-1,6,9,14-tetrol |
|---|---|
| PubChem CID | 57175199 |
| Molecular Formula | C28H54O9 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | 7-(1,6,9,14-tetrahydroxytetradec-7-en-7-yloxy)tetradec-7-ene-1,6,9,14-tetrol |
| SMILES | OCCCCCC(O)C=C(OC(=CC(O)CCCCCO)C(O)CCCCCO)C(O)CCCCCO |
| InChI | InChI=1S/C28H54O9/c29-17-9-1-5-13-23(33)21-27(25(35)15-7-3-11-19-31)37-28(26(36)16-8-4-12-20-32)22-24(34)14-6-2-10-18-30/h21-26,29-36H,1-20H2 |
| InChIKey | NQLXYDOVXAYHSW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|